C19H16BrNO5S2 — CID 175564414
2-(4-bromophenyl)-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)thiophene (PubChem CID 175564414) has the molecular formula C19H16BrNO5S2 and a molecular weight of 482.38 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)thiophene.
| Compound Name | 2-(4-bromophenyl)-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)thiophene |
|---|---|
| PubChem CID | 175564414 |
| Molecular Formula | C19H16BrNO5S2 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | 2-(4-bromophenyl)-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)thiophene |
| SMILES | COC(=O)c1ccc(N(c2ccc(-c3ccc(Br)cc3)s2)S(=O)O)c(OC)c1 |
| InChI | InChI=1S/C19H16BrNO5S2/c1-25-16-11-13(19(22)26-2)5-8-15(16)21(28(23)24)18-10-9-17(27-18)12-3-6-14(20)7-4-12/h3-11H,1-2H3,(H,23,24) |
| InChIKey | TXGIWQUHYSBOKL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|