C16H13ClN2O5S2 — CID 175564425
2-chloro-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)-1,3-benzothiazole (PubChem CID 175564425) has the molecular formula C16H13ClN2O5S2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 2-chloro-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)-1,3-benzothiazole.
| Compound Name | 2-chloro-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)-1,3-benzothiazole |
|---|---|
| PubChem CID | 175564425 |
| Molecular Formula | C16H13ClN2O5S2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 2-chloro-5-(2-methoxy-4-methoxycarbonyl-N-sulfinoanilino)-1,3-benzothiazole |
| SMILES | COC(=O)c1ccc(N(c2ccc3sc(Cl)nc3c2)S(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H13ClN2O5S2/c1-23-13-7-9(15(20)24-2)3-5-12(13)19(26(21)22)10-4-6-14-11(8-10)18-16(17)25-14/h3-8H,1-2H3,(H,21,22) |
| InChIKey | XZIAAMIWDJONAA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|