C20H21BrN2O3S2 — CID 167475519
ethane;methyl 4-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzoate (PubChem CID 167475519) has the molecular formula C20H21BrN2O3S2 and a molecular weight of 481.44 g/mol. Its IUPAC name is ethane;methyl 4-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzoate.
| Compound Name | ethane;methyl 4-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 167475519 |
| Molecular Formula | C20H21BrN2O3S2 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | ethane;methyl 4-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzoate |
| SMILES | CC.COC(=O)c1ccc(NSc2cnc(-c3ccc(Br)cc3)s2)c(OC)c1 |
| InChI | InChI=1S/C18H15BrN2O3S2.C2H6/c1-23-15-9-12(18(22)24-2)5-8-14(15)21-26-16-10-20-17(25-16)11-3-6-13(19)7-4-11;1-2/h3-10,21H,1-2H3;1-2H3 |
| InChIKey | SYPTZUOKQNRCPN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|