C16H11FN2O2S2 — CID 167475840
2-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoic acid (PubChem CID 167475840) has the molecular formula C16H11FN2O2S2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoic acid.
| Compound Name | 2-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 167475840 |
| Molecular Formula | C16H11FN2O2S2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NSc1cnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H11FN2O2S2/c17-11-7-5-10(6-8-11)15-18-9-14(22-15)23-19-13-4-2-1-3-12(13)16(20)21/h1-9,19H,(H,20,21) |
| InChIKey | UJKHYQWYMFWIFN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|