About methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate
methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate (PubChem CID 167475863) has the molecular formula C21H15FN2O2S2
and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate |
| PubChem CID | 167475863 |
| Molecular Formula | C21H15FN2O2S2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cc(NSc3cnc(-c4ccc(F)cc4)s3)ccc2c1 |
| InChI | InChI=1S/C21H15FN2O2S2/c1-26-21(25)16-3-2-15-11-18(9-6-14(15)10-16)24-28-19-12-23-20(27-19)13-4-7-17(22)8-5-13/h2-12,24H,1H3 |
| InChIKey | BHMPGXMAKBGDRW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate?
The IUPAC name of methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate (CID 167475863) is methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate.
What is the SMILES notation for methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate?
The canonical SMILES for methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate is COC(=O)c1ccc2cc(NSc3cnc(-c4ccc(F)cc4)s3)ccc2c1.
What is the InChIKey of methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate?
The InChIKey is BHMPGXMAKBGDRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FN2O2S2/c1-26-21(25)16-3-2-15-11-18(9-6-14(15)10-16)24-28-19-12-23-20(27-19)13-4-7-17(22)8-5-13/h2-12,24H,1H3.
What are the key properties of methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate?
methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate has a molecular weight of 410.50 g/mol, XLogP of 6.01, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate is sourced from PubChem (CID 167475863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).