C21H15FN2O2S2 — CID 167475863
methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate (PubChem CID 167475863) has the molecular formula C21H15FN2O2S2 and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate.
| Compound Name | methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 167475863 |
| Molecular Formula | C21H15FN2O2S2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | methyl 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cc(NSc3cnc(-c4ccc(F)cc4)s3)ccc2c1 |
| InChI | InChI=1S/C21H15FN2O2S2/c1-26-21(25)16-3-2-15-11-18(9-6-14(15)10-16)24-28-19-12-23-20(27-19)13-4-7-17(22)8-5-13/h2-12,24H,1H3 |
| InChIKey | BHMPGXMAKBGDRW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|