C20H18FN3O4S3 — CID 167476363
N-cyclopropylsulfonyl-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzamide (PubChem CID 167476363) has the molecular formula C20H18FN3O4S3 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzamide.
| Compound Name | N-cyclopropylsulfonyl-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 167476363 |
| Molecular Formula | C20H18FN3O4S3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | N-cyclopropylsulfonyl-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)C2CC2)ccc1NSc1cnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H18FN3O4S3/c1-28-17-10-13(19(25)24-31(26,27)15-7-8-15)4-9-16(17)23-30-18-11-22-20(29-18)12-2-5-14(21)6-3-12/h2-6,9-11,15,23H,7-8H2,1H3,(H,24,25) |
| InChIKey | KGDWVPRUDXTYTP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|