C20H19FN2O3S2 — CID 167476829
ethyl 3-ethoxy-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoate (PubChem CID 167476829) has the molecular formula C20H19FN2O3S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 3-ethoxy-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoate.
| Compound Name | ethyl 3-ethoxy-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoate |
|---|---|
| PubChem CID | 167476829 |
| Molecular Formula | C20H19FN2O3S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | ethyl 3-ethoxy-4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NSc2cnc(-c3ccc(F)cc3)s2)c(OCC)c1 |
| InChI | InChI=1S/C20H19FN2O3S2/c1-3-25-17-11-14(20(24)26-4-2)7-10-16(17)23-28-18-12-22-19(27-18)13-5-8-15(21)9-6-13/h5-12,23H,3-4H2,1-2H3 |
| InChIKey | LWNWWPVTZUEMIA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|