C18H16FN3O3S2 — CID 167476472
4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-N,3-dimethoxybenzamide (PubChem CID 167476472) has the molecular formula C18H16FN3O3S2 and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-N,3-dimethoxybenzamide.
| Compound Name | 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-N,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 167476472 |
| Molecular Formula | C18H16FN3O3S2 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]sulfanylamino]-N,3-dimethoxybenzamide |
| SMILES | CONC(=O)c1ccc(NSc2cnc(-c3ccc(F)cc3)s2)c(OC)c1 |
| InChI | InChI=1S/C18H16FN3O3S2/c1-24-15-9-12(17(23)21-25-2)5-8-14(15)22-27-16-10-20-18(26-16)11-3-6-13(19)7-4-11/h3-10,22H,1-2H3,(H,21,23) |
| InChIKey | UZNWUGUITYOTJA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|