C17H13FN2O4S2 — CID 175564461
4-[[2-(4-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]-sulfinoamino]benzoic acid (PubChem CID 175564461) has the molecular formula C17H13FN2O4S2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]-sulfinoamino]benzoic acid.
| Compound Name | 4-[[2-(4-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]-sulfinoamino]benzoic acid |
|---|---|
| PubChem CID | 175564461 |
| Molecular Formula | C17H13FN2O4S2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]-sulfinoamino]benzoic acid |
| SMILES | Cc1sc(-c2ccc(F)cc2)nc1N(c1ccc(C(=O)O)cc1)S(=O)O |
| InChI | InChI=1S/C17H13FN2O4S2/c1-10-15(19-16(25-10)11-2-6-13(18)7-3-11)20(26(23)24)14-8-4-12(5-9-14)17(21)22/h2-9H,1H3,(H,21,22)(H,23,24) |
| InChIKey | IAZHBHJXHXFELV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|