C18H19NO5 — CID 175567779
carbamoyl 2-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetate (PubChem CID 175567779) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is carbamoyl 2-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetate.
| Compound Name | carbamoyl 2-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 175567779 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | carbamoyl 2-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetate |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(OCC(=O)OC(N)=O)cc1 |
| InChI | InChI=1S/C18H19NO5/c1-18(2,12-3-7-14(20)8-4-12)13-5-9-15(10-6-13)23-11-16(21)24-17(19)22/h3-10,20H,11H2,1-2H3,(H2,19,22) |
| InChIKey | NQYABDIAMICESF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|