C21H26O4 — CID 54549761
[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,3-dimethylbutaneperoxoate (PubChem CID 54549761) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,3-dimethylbutaneperoxoate.
| Compound Name | [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,3-dimethylbutaneperoxoate |
|---|---|
| PubChem CID | 54549761 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,3-dimethylbutaneperoxoate |
| SMILES | CC(C)(C)CC(=O)OOc1ccc(C(C)(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H26O4/c1-20(2,3)14-19(23)25-24-18-12-8-16(9-13-18)21(4,5)15-6-10-17(22)11-7-15/h6-13,22H,14H2,1-5H3 |
| InChIKey | ZJBUNEWXXGDYPU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|