C15H20N5O7P2S2+ — CID 175568663
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono 1,3-thiazol-2-yl phosphate (PubChem CID 175568663) has the molecular formula C15H20N5O7P2S2+ and a molecular weight of 508.44 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono 1,3-thiazol-2-yl phosphate.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono 1,3-thiazol-2-yl phosphate |
|---|---|
| PubChem CID | 175568663 |
| Molecular Formula | C15H20N5O7P2S2+ |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono 1,3-thiazol-2-yl phosphate |
| SMILES | Cc1ncc(C[n+]2csc(CCOP(=O)(Oc3nccs3)OP(=O)(O)O)c2C)c(N)n1 |
| InChI | InChI=1S/C15H19N5O7P2S2/c1-10-13(31-9-20(10)8-12-7-18-11(2)19-14(12)16)3-5-25-29(24,27-28(21,22)23)26-15-17-4-6-30-15/h4,6-7,9H,3,5,8H2,1-2H3,(H3-,16,18,19,21,22,23)/p+1 |
| InChIKey | BOLWBBZSNXLPFD-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 170.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|