C11H9BrFN3O — CID 175572730
N-(4-bromo-2-fluoro-5-methylphenyl)-1H-imidazole-5-carboxamide (PubChem CID 175572730) has the molecular formula C11H9BrFN3O and a molecular weight of 298.12 g/mol. Its IUPAC name is N-(4-bromo-2-fluoro-5-methylphenyl)-1H-imidazole-5-carboxamide.
| Compound Name | N-(4-bromo-2-fluoro-5-methylphenyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 175572730 |
| Molecular Formula | C11H9BrFN3O |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | N-(4-bromo-2-fluoro-5-methylphenyl)-1H-imidazole-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnc[nH]2)c(F)cc1Br |
| InChI | InChI=1S/C11H9BrFN3O/c1-6-2-9(8(13)3-7(6)12)16-11(17)10-4-14-5-15-10/h2-5H,1H3,(H,14,15)(H,16,17) |
| InChIKey | NOHXCLXLYYQRQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |