C15H17BrFN3O4S — CID 139392188
2-[5-[(4-bromo-2-fluoro-5-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]ethyl methanesulfonate (PubChem CID 139392188) has the molecular formula C15H17BrFN3O4S and a molecular weight of 434.29 g/mol. Its IUPAC name is 2-[5-[(4-bromo-2-fluoro-5-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[5-[(4-bromo-2-fluoro-5-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139392188 |
| Molecular Formula | C15H17BrFN3O4S |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 2-[5-[(4-bromo-2-fluoro-5-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]ethyl methanesulfonate |
| SMILES | Cc1cc(NC(=O)c2c(CCOS(C)(=O)=O)cnn2C)c(F)cc1Br |
| InChI | InChI=1S/C15H17BrFN3O4S/c1-9-6-13(12(17)7-11(9)16)19-15(21)14-10(8-18-20(14)2)4-5-24-25(3,22)23/h6-8H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | OXQJKZCZZBTHIS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|