C20H14F2N4O3S — CID 175576914
2,4-difluoro-N-(2-methoxy-5-pyridazin-4-ylquinolin-6-yl)benzenesulfonamide (PubChem CID 175576914) has the molecular formula C20H14F2N4O3S and a molecular weight of 428.42 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-methoxy-5-pyridazin-4-ylquinolin-6-yl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-(2-methoxy-5-pyridazin-4-ylquinolin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 175576914 |
| Molecular Formula | C20H14F2N4O3S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2,4-difluoro-N-(2-methoxy-5-pyridazin-4-ylquinolin-6-yl)benzenesulfonamide |
| SMILES | COc1ccc2c(-c3ccnnc3)c(NS(=O)(=O)c3ccc(F)cc3F)ccc2n1 |
| InChI | InChI=1S/C20H14F2N4O3S/c1-29-19-7-3-14-16(25-19)4-5-17(20(14)12-8-9-23-24-11-12)26-30(27,28)18-6-2-13(21)10-15(18)22/h2-11,26H,1H3 |
| InChIKey | KYEPPWWFAMQMNM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |