About 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde
6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde (PubChem CID 175581252) has the molecular formula C13H16ClNO3
and a molecular weight of 269.73 g/mol. Its IUPAC name is 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde |
| PubChem CID | 175581252 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde |
| SMILES | O=CC1COc2ccc(OCCCCCl)cc2N1 |
| InChI | InChI=1S/C13H16ClNO3/c14-5-1-2-6-17-11-3-4-13-12(7-11)15-10(8-16)9-18-13/h3-4,7-8,10,15H,1-2,5-6,9H2 |
| InChIKey | HOZDYEJOXLFXIU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde?
The IUPAC name of 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde (CID 175581252) is 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde.
What is the SMILES notation for 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde?
The canonical SMILES for 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde is O=CC1COc2ccc(OCCCCCl)cc2N1.
What is the InChIKey of 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde?
The InChIKey is HOZDYEJOXLFXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO3/c14-5-1-2-6-17-11-3-4-13-12(7-11)15-10(8-16)9-18-13/h3-4,7-8,10,15H,1-2,5-6,9H2.
What are the key properties of 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde?
6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde has a molecular weight of 269.73 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorobutoxy)-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde is sourced from PubChem (CID 175581252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).