About azane;1H-azet-2-one;triethoxy(pentyl)silane
azane;1H-azet-2-one;triethoxy(pentyl)silane (PubChem CID 175582558) has the molecular formula C14H32N2O4Si
and a molecular weight of 320.51 g/mol. Its IUPAC name is azane;1H-azet-2-one;triethoxy(pentyl)silane.
Molecular Properties
| Compound Name | azane;1H-azet-2-one;triethoxy(pentyl)silane |
| PubChem CID | 175582558 |
| Molecular Formula | C14H32N2O4Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | azane;1H-azet-2-one;triethoxy(pentyl)silane |
| SMILES | CCCCC[Si](OCC)(OCC)OCC.N.O=C1C=CN1 |
| InChI | InChI=1S/C11H26O3Si.C3H3NO.H3N/c1-5-9-10-11-15(12-6-2,13-7-3)14-8-4;5-3-1-2-4-3;/h5-11H2,1-4H3;1-2H,(H,4,5);1H3 |
| InChIKey | NHVXWKAOQNAYOW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;1H-azet-2-one;triethoxy(pentyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1H-azet-2-one;triethoxy(pentyl)silane?
The IUPAC name of azane;1H-azet-2-one;triethoxy(pentyl)silane (CID 175582558) is azane;1H-azet-2-one;triethoxy(pentyl)silane.
What is the SMILES notation for azane;1H-azet-2-one;triethoxy(pentyl)silane?
The canonical SMILES for azane;1H-azet-2-one;triethoxy(pentyl)silane is CCCCC[Si](OCC)(OCC)OCC.N.O=C1C=CN1.
What is the InChIKey of azane;1H-azet-2-one;triethoxy(pentyl)silane?
The InChIKey is NHVXWKAOQNAYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O3Si.C3H3NO.H3N/c1-5-9-10-11-15(12-6-2,13-7-3)14-8-4;5-3-1-2-4-3;/h5-11H2,1-4H3;1-2H,(H,4,5);1H3.
What are the key properties of azane;1H-azet-2-one;triethoxy(pentyl)silane?
azane;1H-azet-2-one;triethoxy(pentyl)silane has a molecular weight of 320.51 g/mol, XLogP of 3.02, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1H-azet-2-one;triethoxy(pentyl)silane is sourced from PubChem (CID 175582558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).