About 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole
4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole (PubChem CID 175582667) has the molecular formula C19H16N4OS
and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole |
| PubChem CID | 175582667 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole |
| SMILES | Cc1ccc(S)cc1.c1ccc(-c2noc(-c3cncnc3)n2)cc1 |
| InChI | InChI=1S/C12H8N4O.C7H8S/c1-2-4-9(5-3-1)11-15-12(17-16-11)10-6-13-8-14-7-10;1-6-2-4-7(8)5-3-6/h1-8H;2-5,8H,1H3 |
| InChIKey | PPRIYITVDTXOEM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole?
The IUPAC name of 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole (CID 175582667) is 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole.
What is the SMILES notation for 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole?
The canonical SMILES for 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole is Cc1ccc(S)cc1.c1ccc(-c2noc(-c3cncnc3)n2)cc1.
What is the InChIKey of 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole?
The InChIKey is PPRIYITVDTXOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O.C7H8S/c1-2-4-9(5-3-1)11-15-12(17-16-11)10-6-13-8-14-7-10;1-6-2-4-7(8)5-3-6/h1-8H;2-5,8H,1H3.
What are the key properties of 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole?
4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole has a molecular weight of 348.43 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole is sourced from PubChem (CID 175582667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).