C19H16N4OS — CID 175582667
4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole (PubChem CID 175582667) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole.
| Compound Name | 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 175582667 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-methylbenzenethiol;3-phenyl-5-pyrimidin-5-yl-1,2,4-oxadiazole |
| SMILES | Cc1ccc(S)cc1.c1ccc(-c2noc(-c3cncnc3)n2)cc1 |
| InChI | InChI=1S/C12H8N4O.C7H8S/c1-2-4-9(5-3-1)11-15-12(17-16-11)10-6-13-8-14-7-10;1-6-2-4-7(8)5-3-6/h1-8H;2-5,8H,1H3 |
| InChIKey | PPRIYITVDTXOEM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|