C12H22NO4Zn- — CID 175583050
2-methylpropyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc (PubChem CID 175583050) has the molecular formula C12H22NO4Zn- and a molecular weight of 309.70 g/mol. Its IUPAC name is 2-methylpropyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc.
| Compound Name | 2-methylpropyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc |
|---|---|
| PubChem CID | 175583050 |
| Molecular Formula | C12H22NO4Zn- |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-methylpropyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc |
| SMILES | [CH2-]C(NC(=O)OC(C)(C)C)C(=O)OCC(C)C.[Zn] |
| InChI | InChI=1S/C12H22NO4.Zn/c1-8(2)7-16-10(14)9(3)13-11(15)17-12(4,5)6;/h8-9H,3,7H2,1-2,4-6H3,(H,13,15);/q-1; |
| InChIKey | OHLHMIFLQXUTPF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|