C15H16ClF2N3O2 — CID 175590738
tert-butyl N-[4-(2-chloro-3,5-difluoro-1H-pyridin-2-yl)-3-pyridinyl]carbamate (PubChem CID 175590738) has the molecular formula C15H16ClF2N3O2 and a molecular weight of 343.76 g/mol. Its IUPAC name is tert-butyl N-[4-(2-chloro-3,5-difluoro-1H-pyridin-2-yl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-chloro-3,5-difluoro-1H-pyridin-2-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 175590738 |
| Molecular Formula | C15H16ClF2N3O2 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | tert-butyl N-[4-(2-chloro-3,5-difluoro-1H-pyridin-2-yl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnccc1C1(Cl)NC=C(F)C=C1F |
| InChI | InChI=1S/C15H16ClF2N3O2/c1-14(2,3)23-13(22)21-11-8-19-5-4-10(11)15(16)12(18)6-9(17)7-20-15/h4-8,20H,1-3H3,(H,21,22) |
| InChIKey | ICNGYNILQLVNAA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|