C22H23FN2O2S — CID 175591490
4-ethyl-2-[2-(2-fluorophenyl)-5-(methylaminomethyl)phenyl]benzenesulfonamide (PubChem CID 175591490) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-ethyl-2-[2-(2-fluorophenyl)-5-(methylaminomethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-ethyl-2-[2-(2-fluorophenyl)-5-(methylaminomethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175591490 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-ethyl-2-[2-(2-fluorophenyl)-5-(methylaminomethyl)phenyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(N)(=O)=O)c(-c2cc(CNC)ccc2-c2ccccc2F)c1 |
| InChI | InChI=1S/C22H23FN2O2S/c1-3-15-9-11-22(28(24,26)27)20(12-15)19-13-16(14-25-2)8-10-17(19)18-6-4-5-7-21(18)23/h4-13,25H,3,14H2,1-2H3,(H2,24,26,27) |
| InChIKey | UHVSJQAWSPAGNG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |