C21H19F3Sn — CID 175592498
triphenyl(2,3,3-trifluoropropyl)stannane (PubChem CID 175592498) has the molecular formula C21H19F3Sn and a molecular weight of 447.09 g/mol. Its IUPAC name is triphenyl(2,3,3-trifluoropropyl)stannane.
| Compound Name | triphenyl(2,3,3-trifluoropropyl)stannane |
|---|---|
| PubChem CID | 175592498 |
| Molecular Formula | C21H19F3Sn |
| Molecular Weight | 447.09 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | triphenyl(2,3,3-trifluoropropyl)stannane |
| SMILES | FC(F)C(F)C[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.C3H4F3.Sn/c3*1-2-4-6-5-3-1;1-2(4)3(5)6;/h3*1-5H;2-3H,1H2; |
| InChIKey | SEJQDAWAHKKTFH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.09 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |