C9H9F3Te — CID 19025120
1,2,2-trifluoroethyltellanylmethylbenzene (PubChem CID 19025120) has the molecular formula C9H9F3Te and a molecular weight of 301.76 g/mol. Its IUPAC name is 1,2,2-trifluoroethyltellanylmethylbenzene.
| Compound Name | 1,2,2-trifluoroethyltellanylmethylbenzene |
|---|---|
| PubChem CID | 19025120 |
| Molecular Formula | C9H9F3Te |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 1,2,2-trifluoroethyltellanylmethylbenzene |
| SMILES | FC(F)C(F)[Te]Cc1ccccc1 |
| InChI | InChI=1S/C9H9F3Te/c10-8(11)9(12)13-6-7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | CWUXYZDCSGAURJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|