C10H11F3N2O2 — CID 175596848
4-[1-(dimethylamino)-1,2,2-trifluoroethyl]pyridine-2-carboxylic acid (PubChem CID 175596848) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-[1-(dimethylamino)-1,2,2-trifluoroethyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[1-(dimethylamino)-1,2,2-trifluoroethyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 175596848 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-[1-(dimethylamino)-1,2,2-trifluoroethyl]pyridine-2-carboxylic acid |
| SMILES | CN(C)C(F)(c1ccnc(C(=O)O)c1)C(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c1-15(2)10(13,9(11)12)6-3-4-14-7(5-6)8(16)17/h3-5,9H,1-2H3,(H,16,17) |
| InChIKey | NEKMOIASPBYSMN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|