C21H30Cl2N2O2Si — CID 175603511
1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-(4-trimethylsilyloxycyclohex-3-en-1-yl)ethanone (PubChem CID 175603511) has the molecular formula C21H30Cl2N2O2Si and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-(4-trimethylsilyloxycyclohex-3-en-1-yl)ethanone.
| Compound Name | 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-(4-trimethylsilyloxycyclohex-3-en-1-yl)ethanone |
|---|---|
| PubChem CID | 175603511 |
| Molecular Formula | C21H30Cl2N2O2Si |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-(4-trimethylsilyloxycyclohex-3-en-1-yl)ethanone |
| SMILES | C[Si](C)(C)OC1=CCC(CC(=O)N2CCN(c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C21H30Cl2N2O2Si/c1-28(2,3)27-17-9-7-16(8-10-17)15-20(26)25-13-11-24(12-14-25)19-6-4-5-18(22)21(19)23/h4-6,9,16H,7-8,10-15H2,1-3H3 |
| InChIKey | SKJRLRZLYKMXJE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|