About azane;1H-imidazole-4,5-dicarbonitrile
azane;1H-imidazole-4,5-dicarbonitrile (PubChem CID 175608883) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is azane;1H-imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | azane;1H-imidazole-4,5-dicarbonitrile |
| PubChem CID | 175608883 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | azane;1H-imidazole-4,5-dicarbonitrile |
| SMILES | N.N#Cc1nc[nH]c1C#N |
| InChI | InChI=1S/C5H2N4.H3N/c6-1-4-5(2-7)9-3-8-4;/h3H,(H,8,9);1H3 |
| InChIKey | DGVNGGNJYLJGAJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;1H-imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1H-imidazole-4,5-dicarbonitrile?
The IUPAC name of azane;1H-imidazole-4,5-dicarbonitrile (CID 175608883) is azane;1H-imidazole-4,5-dicarbonitrile.
What is the SMILES notation for azane;1H-imidazole-4,5-dicarbonitrile?
The canonical SMILES for azane;1H-imidazole-4,5-dicarbonitrile is N.N#Cc1nc[nH]c1C#N.
What is the InChIKey of azane;1H-imidazole-4,5-dicarbonitrile?
The InChIKey is DGVNGGNJYLJGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N4.H3N/c6-1-4-5(2-7)9-3-8-4;/h3H,(H,8,9);1H3.
What are the key properties of azane;1H-imidazole-4,5-dicarbonitrile?
azane;1H-imidazole-4,5-dicarbonitrile has a molecular weight of 135.13 g/mol, XLogP of 0.32, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1H-imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 175608883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).