C8H6N4 — CID 84763973
2-(1H-imidazo[4,5-b]pyridin-7-yl)acetonitrile (PubChem CID 84763973) has the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-7-yl)acetonitrile.
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-7-yl)acetonitrile |
|---|---|
| PubChem CID | 84763973 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-7-yl)acetonitrile |
| SMILES | N#CCc1ccnc2nc[nH]c12 |
| InChI | InChI=1S/C8H6N4/c9-3-1-6-2-4-10-8-7(6)11-5-12-8/h2,4-5H,1H2,(H,10,11,12) |
| InChIKey | RFTWYUNHPWSXCO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |