C5H2N4 — CID 23561826
5-isocyano-1H-imidazole-4-carbonitrile (PubChem CID 23561826) has the molecular formula C5H2N4 and a molecular weight of 118.10 g/mol. Its IUPAC name is 5-isocyano-1H-imidazole-4-carbonitrile.
| Compound Name | 5-isocyano-1H-imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 23561826 |
| Molecular Formula | C5H2N4 |
| Molecular Weight | 118.10 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 5-isocyano-1H-imidazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1[nH]cnc1C#N |
| InChI | InChI=1S/C5H2N4/c1-7-5-4(2-6)8-3-9-5/h3H,(H,8,9) |
| InChIKey | BDOYXZBBSBKLQG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 56.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.10 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|