C14H28FNO — CID 175612289
3,4-ditert-butyl-6-fluoro-6-methyl-1,4-oxazepane (PubChem CID 175612289) has the molecular formula C14H28FNO and a molecular weight of 245.38 g/mol. Its IUPAC name is 3,4-ditert-butyl-6-fluoro-6-methyl-1,4-oxazepane.
| Compound Name | 3,4-ditert-butyl-6-fluoro-6-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 175612289 |
| Molecular Formula | C14H28FNO |
| Molecular Weight | 245.38 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 3,4-ditert-butyl-6-fluoro-6-methyl-1,4-oxazepane |
| SMILES | CC1(F)COCC(C(C)(C)C)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H28FNO/c1-12(2,3)11-8-17-10-14(7,15)9-16(11)13(4,5)6/h11H,8-10H2,1-7H3 |
| InChIKey | VEPWYFAGIDJAMN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |