C21H26Cl2S — CID 175612577
2-chloro-4-[3-(2-chlorophenyl)sulfanyl-2-methylpropyl]-1-(3-methylbutyl)benzene (PubChem CID 175612577) has the molecular formula C21H26Cl2S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-chloro-4-[3-(2-chlorophenyl)sulfanyl-2-methylpropyl]-1-(3-methylbutyl)benzene.
| Compound Name | 2-chloro-4-[3-(2-chlorophenyl)sulfanyl-2-methylpropyl]-1-(3-methylbutyl)benzene |
|---|---|
| PubChem CID | 175612577 |
| Molecular Formula | C21H26Cl2S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-chloro-4-[3-(2-chlorophenyl)sulfanyl-2-methylpropyl]-1-(3-methylbutyl)benzene |
| SMILES | CC(C)CCc1ccc(CC(C)CSc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C21H26Cl2S/c1-15(2)8-10-18-11-9-17(13-20(18)23)12-16(3)14-24-21-7-5-4-6-19(21)22/h4-7,9,11,13,15-16H,8,10,12,14H2,1-3H3 |
| InChIKey | BXLNUKYNRLHGIC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |