C23H37F7O5 — CID 175617932
1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-O-(2-hydroxyethyl) 2-fluoro-3,6-dimethyl-2-(2-methylpropyl)-8-propan-2-ylnonanedioate (PubChem CID 175617932) has the molecular formula C23H37F7O5 and a molecular weight of 526.53 g/mol. Its IUPAC name is 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-O-(2-hydroxyethyl) 2-fluoro-3,6-dimethyl-2-(2-methylpropyl)-8-propan-2-ylnonanedioate.
| Compound Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-O-(2-hydroxyethyl) 2-fluoro-3,6-dimethyl-2-(2-methylpropyl)-8-propan-2-ylnonanedioate |
|---|---|
| PubChem CID | 175617932 |
| Molecular Formula | C23H37F7O5 |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-O-(2-hydroxyethyl) 2-fluoro-3,6-dimethyl-2-(2-methylpropyl)-8-propan-2-ylnonanedioate |
| SMILES | CC(C)CC(F)(C(=O)OC(C(F)(F)F)C(F)(F)F)C(C)CCC(C)CC(C(=O)OCCO)C(C)C |
| InChI | InChI=1S/C23H37F7O5/c1-13(2)12-21(24,20(33)35-19(22(25,26)27)23(28,29)30)16(6)8-7-15(5)11-17(14(3)4)18(32)34-10-9-31/h13-17,19,31H,7-12H2,1-6H3 |
| InChIKey | RAWQVEZYJVXQNQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |