C12H8Cl2IN — CID 175620459
2,6-dichloro-N-(2-iodophenyl)aniline (PubChem CID 175620459) has the molecular formula C12H8Cl2IN and a molecular weight of 364.01 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-iodophenyl)aniline.
| Compound Name | 2,6-dichloro-N-(2-iodophenyl)aniline |
|---|---|
| PubChem CID | 175620459 |
| Molecular Formula | C12H8Cl2IN |
| Molecular Weight | 364.01 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | 2,6-dichloro-N-(2-iodophenyl)aniline |
| SMILES | Clc1cccc(Cl)c1Nc1ccccc1I |
| InChI | InChI=1S/C12H8Cl2IN/c13-8-4-3-5-9(14)12(8)16-11-7-2-1-6-10(11)15/h1-7,16H |
| InChIKey | ROXHAMOZCVBPJE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.01 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|