C9H14FN — CID 175623362
6-butan-2-yl-2-fluoro-1,2-dihydropyridine (PubChem CID 175623362) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 6-butan-2-yl-2-fluoro-1,2-dihydropyridine.
| Compound Name | 6-butan-2-yl-2-fluoro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 175623362 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 6-butan-2-yl-2-fluoro-1,2-dihydropyridine |
| SMILES | CCC(C)C1=CC=CC(F)N1 |
| InChI | InChI=1S/C9H14FN/c1-3-7(2)8-5-4-6-9(10)11-8/h4-7,9,11H,3H2,1-2H3 |
| InChIKey | WKCORDOFVBSPMI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|