C19H25O2P — CID 175623797
(5Z,6Z,8E)-5-ethylidene-8-methoxy-1-phenylphosphanyldeca-6,8-dien-1-one (PubChem CID 175623797) has the molecular formula C19H25O2P and a molecular weight of 316.38 g/mol. Its IUPAC name is (5Z,6Z,8E)-5-ethylidene-8-methoxy-1-phenylphosphanyldeca-6,8-dien-1-one.
| Compound Name | (5Z,6Z,8E)-5-ethylidene-8-methoxy-1-phenylphosphanyldeca-6,8-dien-1-one |
|---|---|
| PubChem CID | 175623797 |
| Molecular Formula | C19H25O2P |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (5Z,6Z,8E)-5-ethylidene-8-methoxy-1-phenylphosphanyldeca-6,8-dien-1-one |
| SMILES | C/C=C(\C=C/C(=C\C)OC)CCCC(=O)Pc1ccccc1 |
| InChI | InChI=1S/C19H25O2P/c1-4-16(14-15-17(5-2)21-3)10-9-13-19(20)22-18-11-7-6-8-12-18/h4-8,11-12,14-15,22H,9-10,13H2,1-3H3/b15-14-,16-4-,17-5+ |
| InChIKey | IWTKBVNZPHRRBL-KKWJMUCBSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|