C44H18F8O19S6 — CID 175627905
8-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3,6,8-trisulfopyren-1-yl)oxyphenyl]phenyl]pyrene-1,3,6-trisulfonic acid (PubChem CID 175627905) has the molecular formula C44H18F8O19S6 and a molecular weight of 1194.99 g/mol. Its IUPAC name is 8-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3,6,8-trisulfopyren-1-yl)oxyphenyl]phenyl]pyrene-1,3,6-trisulfonic acid.
| Compound Name | 8-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3,6,8-trisulfopyren-1-yl)oxyphenyl]phenyl]pyrene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 175627905 |
| Molecular Formula | C44H18F8O19S6 |
| Molecular Weight | 1194.99 g/mol |
| Exact Mass | 1193.86 |
| IUPAC Name | 8-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3,6,8-trisulfopyren-1-yl)oxyphenyl]phenyl]pyrene-1,3,6-trisulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Oc2c(F)c(F)c(-c3c(F)c(F)c(-c4cc(S(=O)(=O)O)c5ccc6c(S(=O)(=O)O)cc(S(=O)(=O)O)c7ccc4c5c76)c(F)c3F)c(F)c2F)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)c4ccc1c2c34 |
| InChI | InChI=1S/C44H18F8O19S6/c45-36-33(21-9-23(72(53,54)55)15-5-7-19-27(76(65,66)67)11-25(74(59,60)61)17-3-1-13(21)29(15)31(17)19)37(46)39(48)34(38(36)47)35-40(49)42(51)44(43(52)41(35)50)71-22-10-24(73(56,57)58)16-6-8-20-28(77(68,69)70)12-26(75(62,63)64)18-4-2-14(22)30(16)32(18)20/h1-12H,(H,53,54,55)(H,56,57,58)(H,59,60,61)(H,62,63,64)(H,65,66,67)(H,68,69,70) |
| InChIKey | QESQTDJQSALFKH-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 335.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1194.99 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|