C9H12N2 — CID 175635845
8-methyl-4a,5,8,8a-tetrahydrocinnoline (PubChem CID 175635845) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 8-methyl-4a,5,8,8a-tetrahydrocinnoline.
| Compound Name | 8-methyl-4a,5,8,8a-tetrahydrocinnoline |
|---|---|
| PubChem CID | 175635845 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 8-methyl-4a,5,8,8a-tetrahydrocinnoline |
| SMILES | CC1C=CCC2C=CN=NC12 |
| InChI | InChI=1S/C9H12N2/c1-7-3-2-4-8-5-6-10-11-9(7)8/h2-3,5-9H,4H2,1H3 |
| InChIKey | QLLUJFLZEYVOJB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|