C27H24F3N5O2S — CID 175639665
1-(2-amino-2-sulfanylethyl)-6-(1,3-dihydroisoindol-2-yl)-3-(5-methyl-3-pyridinyl)-5-[(3,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 175639665) has the molecular formula C27H24F3N5O2S and a molecular weight of 539.58 g/mol. Its IUPAC name is 1-(2-amino-2-sulfanylethyl)-6-(1,3-dihydroisoindol-2-yl)-3-(5-methyl-3-pyridinyl)-5-[(3,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2-amino-2-sulfanylethyl)-6-(1,3-dihydroisoindol-2-yl)-3-(5-methyl-3-pyridinyl)-5-[(3,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175639665 |
| Molecular Formula | C27H24F3N5O2S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 1-(2-amino-2-sulfanylethyl)-6-(1,3-dihydroisoindol-2-yl)-3-(5-methyl-3-pyridinyl)-5-[(3,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | Cc1cncc(-n2c(=O)c(Cc3cc(F)c(F)c(F)c3)c(N3Cc4ccccc4C3)n(CC(N)S)c2=O)c1 |
| InChI | InChI=1S/C27H24F3N5O2S/c1-15-6-19(11-32-10-15)35-26(36)20(7-16-8-21(28)24(30)22(29)9-16)25(34(27(35)37)14-23(31)38)33-12-17-4-2-3-5-18(17)13-33/h2-6,8-11,23,38H,7,12-14,31H2,1H3 |
| InChIKey | KRLABEJAVHXKJN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|