C25H20F3N7O2 — CID 176510486
2-[6-(1,3-dihydroisoindol-2-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-5-[(3,4,5-trifluorophenyl)methyl]pyrimidin-1-yl]acetonitrile (PubChem CID 176510486) has the molecular formula C25H20F3N7O2 and a molecular weight of 507.48 g/mol. Its IUPAC name is 2-[6-(1,3-dihydroisoindol-2-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-5-[(3,4,5-trifluorophenyl)methyl]pyrimidin-1-yl]acetonitrile.
| Compound Name | 2-[6-(1,3-dihydroisoindol-2-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-5-[(3,4,5-trifluorophenyl)methyl]pyrimidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 176510486 |
| Molecular Formula | C25H20F3N7O2 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-[6-(1,3-dihydroisoindol-2-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-5-[(3,4,5-trifluorophenyl)methyl]pyrimidin-1-yl]acetonitrile |
| SMILES | Cn1cnc(Cn2c(=O)c(Cc3cc(F)c(F)c(F)c3)c(N3Cc4ccccc4C3)n(CC#N)c2=O)n1 |
| InChI | InChI=1S/C25H20F3N7O2/c1-32-14-30-21(31-32)13-35-24(36)18(8-15-9-19(26)22(28)20(27)10-15)23(34(7-6-29)25(35)37)33-11-16-4-2-3-5-17(16)12-33/h2-5,9-10,14H,7-8,11-13H2,1H3 |
| InChIKey | OYFHBSWRXDPRCL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|