C26H15ClF3N9O2 — CID 172537924
4-chloro-3-[12-[(1-methyl-1,2,4-triazol-3-yl)methyl]-11,13-dioxo-10-[(3,4,5-trifluorophenyl)methyl]-3,4,6,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-7-yl]benzonitrile (PubChem CID 172537924) has the molecular formula C26H15ClF3N9O2 and a molecular weight of 577.91 g/mol. Its IUPAC name is 4-chloro-3-[12-[(1-methyl-1,2,4-triazol-3-yl)methyl]-11,13-dioxo-10-[(3,4,5-trifluorophenyl)methyl]-3,4,6,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-7-yl]benzonitrile.
| Compound Name | 4-chloro-3-[12-[(1-methyl-1,2,4-triazol-3-yl)methyl]-11,13-dioxo-10-[(3,4,5-trifluorophenyl)methyl]-3,4,6,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-7-yl]benzonitrile |
|---|---|
| PubChem CID | 172537924 |
| Molecular Formula | C26H15ClF3N9O2 |
| Molecular Weight | 577.91 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 4-chloro-3-[12-[(1-methyl-1,2,4-triazol-3-yl)methyl]-11,13-dioxo-10-[(3,4,5-trifluorophenyl)methyl]-3,4,6,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-7-yl]benzonitrile |
| SMILES | Cn1cnc(Cn2c(=O)c3c(cc(-c4cc(C#N)ccc4Cl)n4cnnc34)n(Cc3cc(F)c(F)c(F)c3)c2=O)n1 |
| InChI | InChI=1S/C26H15ClF3N9O2/c1-36-11-32-21(35-36)10-38-25(40)22-20(37(26(38)41)9-14-5-17(28)23(30)18(29)6-14)7-19(39-12-33-34-24(22)39)15-4-13(8-31)2-3-16(15)27/h2-7,11-12H,9-10H2,1H3 |
| InChIKey | OYHDDZHRLWCUEZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.91 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|