C27H22ClF3N6O4S — CID 172537807
7-[2-chloro-5-(methylsulfonimidoyl)phenyl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione (PubChem CID 172537807) has the molecular formula C27H22ClF3N6O4S and a molecular weight of 619.03 g/mol. Its IUPAC name is 7-[2-chloro-5-(methylsulfonimidoyl)phenyl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 7-[2-chloro-5-(methylsulfonimidoyl)phenyl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 172537807 |
| Molecular Formula | C27H22ClF3N6O4S |
| Molecular Weight | 619.03 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | 7-[2-chloro-5-(methylsulfonimidoyl)phenyl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione |
| SMILES | [H]N=S(C)(=O)c1ccc(Cl)c(-c2cc(OC)c3c(=O)n(Cc4ncn(C)n4)c(=O)n(Cc4cc(F)c(F)c(F)c4)c3c2)c1 |
| InChI | InChI=1S/C27H22ClF3N6O4S/c1-35-13-33-23(34-35)12-37-26(38)24-21(36(27(37)39)11-14-6-19(29)25(31)20(30)7-14)8-15(9-22(24)41-2)17-10-16(42(3,32)40)4-5-18(17)28/h4-10,13,32H,11-12H2,1-3H3 |
| InChIKey | KFHVIGWNIOFBBG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.03 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|