C24H23F3N8O3 — CID 172538030
7-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 172538030) has the molecular formula C24H23F3N8O3 and a molecular weight of 528.50 g/mol. Its IUPAC name is 7-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172538030 |
| Molecular Formula | C24H23F3N8O3 |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 7-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-5-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | COc1nc(N2C[C@H]3C[C@@H]2CN3)cc2c1c(=O)n(Cc1ncn(C)n1)c(=O)n2Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C24H23F3N8O3/c1-32-11-29-18(31-32)10-35-23(36)20-17(34(24(35)37)8-12-3-15(25)21(27)16(26)4-12)6-19(30-22(20)38-2)33-9-13-5-14(33)7-28-13/h3-4,6,11,13-14,28H,5,7-10H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | ZJKHKRVQVADNLA-ZIAGYGMSSA-N |
| XLogP | 0.76 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|