C26H17ClF3N7O3 — CID 172537731
4-chloro-3-[6-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-1-[(3,4,5-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-7-yl]benzonitrile (PubChem CID 172537731) has the molecular formula C26H17ClF3N7O3 and a molecular weight of 567.92 g/mol. Its IUPAC name is 4-chloro-3-[6-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-1-[(3,4,5-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-7-yl]benzonitrile.
| Compound Name | 4-chloro-3-[6-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-1-[(3,4,5-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 172537731 |
| Molecular Formula | C26H17ClF3N7O3 |
| Molecular Weight | 567.92 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 4-chloro-3-[6-methoxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2,4-dioxo-1-[(3,4,5-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-7-yl]benzonitrile |
| SMILES | COc1nc2c(=O)n(Cc3ncn(C)n3)c(=O)n(Cc3cc(F)c(F)c(F)c3)c2cc1-c1cc(C#N)ccc1Cl |
| InChI | InChI=1S/C26H17ClF3N7O3/c1-35-12-32-21(34-35)11-37-25(38)23-20(36(26(37)39)10-14-6-18(28)22(30)19(29)7-14)8-16(24(33-23)40-2)15-5-13(9-31)3-4-17(15)27/h3-8,12H,10-11H2,1-2H3 |
| InChIKey | VVZWQICAJAZBMF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 120.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.92 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|