C22H17BrF3N5O3 — CID 172537684
7-bromo-5-hydroxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-6-prop-2-enyl-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione (PubChem CID 172537684) has the molecular formula C22H17BrF3N5O3 and a molecular weight of 536.31 g/mol. Its IUPAC name is 7-bromo-5-hydroxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-6-prop-2-enyl-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 7-bromo-5-hydroxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-6-prop-2-enyl-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 172537684 |
| Molecular Formula | C22H17BrF3N5O3 |
| Molecular Weight | 536.31 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 7-bromo-5-hydroxy-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-6-prop-2-enyl-1-[(3,4,5-trifluorophenyl)methyl]quinazoline-2,4-dione |
| SMILES | C=CCc1c(Br)cc2c(c1O)c(=O)n(Cc1ncn(C)n1)c(=O)n2Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C22H17BrF3N5O3/c1-3-4-12-13(23)7-16-18(20(12)32)21(33)31(9-17-27-10-29(2)28-17)22(34)30(16)8-11-5-14(24)19(26)15(25)6-11/h3,5-7,10,32H,1,4,8-9H2,2H3 |
| InChIKey | GQZYCBCYIHJPGM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|