C9H14N2O2 — CID 175647241
1-(2-hydroxyethyl)-4,5,6-trimethylpyrimidin-2-one (PubChem CID 175647241) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4,5,6-trimethylpyrimidin-2-one.
| Compound Name | 1-(2-hydroxyethyl)-4,5,6-trimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 175647241 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-4,5,6-trimethylpyrimidin-2-one |
| SMILES | Cc1nc(=O)n(CCO)c(C)c1C |
| InChI | InChI=1S/C9H14N2O2/c1-6-7(2)10-9(13)11(4-5-12)8(6)3/h12H,4-5H2,1-3H3 |
| InChIKey | PQHPFQMRLDWNLG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |