C9H15IN2O2 — CID 15787712
1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one iodide (PubChem CID 15787712) has the molecular formula C9H15IN2O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one iodide.
| Compound Name | 1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one iodide |
|---|---|
| PubChem CID | 15787712 |
| Molecular Formula | C9H15IN2O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one iodide |
| SMILES | Cc1cc(C)[n+](C)c(=O)n1CCO.[I-] |
| InChI | InChI=1S/C9H15N2O2.HI/c1-7-6-8(2)11(4-5-12)9(13)10(7)3;/h6,12H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UVJNMRCDYODNDU-UHFFFAOYSA-M |
| XLogP | -3.71 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|