C9H14N2O2 — CID 43509825
1-(3-hydroxypropyl)-4,6-dimethylpyrimidin-2-one (PubChem CID 43509825) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-4,6-dimethylpyrimidin-2-one.
| Compound Name | 1-(3-hydroxypropyl)-4,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 43509825 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-4,6-dimethylpyrimidin-2-one |
| SMILES | Cc1cc(C)n(CCCO)c(=O)n1 |
| InChI | InChI=1S/C9H14N2O2/c1-7-6-8(2)11(4-3-5-12)9(13)10-7/h6,12H,3-5H2,1-2H3 |
| InChIKey | BNBAZSLNRGVGRZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |