C13H27N2O2+ — CID 143494103
ethane;1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one (PubChem CID 143494103) has the molecular formula C13H27N2O2+ and a molecular weight of 243.37 g/mol. Its IUPAC name is ethane;1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one.
| Compound Name | ethane;1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one |
|---|---|
| PubChem CID | 143494103 |
| Molecular Formula | C13H27N2O2+ |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | ethane;1-(2-hydroxyethyl)-3,4,6-trimethylpyrimidin-3-ium-2-one |
| SMILES | CC.CC.Cc1cc(C)[n+](C)c(=O)n1CCO |
| InChI | InChI=1S/C9H15N2O2.2C2H6/c1-7-6-8(2)11(4-5-12)9(13)10(7)3;2*1-2/h6,12H,4-5H2,1-3H3;2*1-2H3/q+1;; |
| InChIKey | MOCVLQNKTSTNGS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|