About 1-methylquinolin-5-imine;hydroiodide
1-methylquinolin-5-imine;hydroiodide (PubChem CID 175647763) has the molecular formula C10H11IN2
and a molecular weight of 286.12 g/mol. Its IUPAC name is 1-methylquinolin-5-imine;hydroiodide.
Molecular Properties
| Compound Name | 1-methylquinolin-5-imine;hydroiodide |
| PubChem CID | 175647763 |
| Molecular Formula | C10H11IN2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 1-methylquinolin-5-imine;hydroiodide |
| SMILES | I.[H]/N=c1\cccc2n(C)cccc1-2 |
| InChI | InChI=1S/C10H10N2.HI/c1-12-7-3-4-8-9(11)5-2-6-10(8)12;/h2-7,11H,1H3;1H/b11-9+; |
| InChIKey | JPEZFBFIRRAFNR-LBEJWNQZSA-N |
| XLogP | 2.23 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methylquinolin-5-imine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylquinolin-5-imine;hydroiodide?
The IUPAC name of 1-methylquinolin-5-imine;hydroiodide (CID 175647763) is 1-methylquinolin-5-imine;hydroiodide.
What is the SMILES notation for 1-methylquinolin-5-imine;hydroiodide?
The canonical SMILES for 1-methylquinolin-5-imine;hydroiodide is I.[H]/N=c1\cccc2n(C)cccc1-2.
What is the InChIKey of 1-methylquinolin-5-imine;hydroiodide?
The InChIKey is JPEZFBFIRRAFNR-LBEJWNQZSA-N. The full InChI is InChI=1S/C10H10N2.HI/c1-12-7-3-4-8-9(11)5-2-6-10(8)12;/h2-7,11H,1H3;1H/b11-9+;.
What are the key properties of 1-methylquinolin-5-imine;hydroiodide?
1-methylquinolin-5-imine;hydroiodide has a molecular weight of 286.12 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylquinolin-5-imine;hydroiodide is sourced from PubChem (CID 175647763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).