C12H12N2 — CID 57191331
1-azatricyclo[7.3.1.05,13]trideca-4,7,9(13),10-tetraen-3-imine (PubChem CID 57191331) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-azatricyclo[7.3.1.05,13]trideca-4,7,9(13),10-tetraen-3-imine.
| Compound Name | 1-azatricyclo[7.3.1.05,13]trideca-4,7,9(13),10-tetraen-3-imine |
|---|---|
| PubChem CID | 57191331 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-azatricyclo[7.3.1.05,13]trideca-4,7,9(13),10-tetraen-3-imine |
| SMILES | [H]/N=C1\C=C2CC=CC3=C2N(CC=C3)C1 |
| InChI | InChI=1S/C12H12N2/c13-11-7-10-4-1-3-9-5-2-6-14(8-11)12(9)10/h1-3,5,7,13H,4,6,8H2/b13-11+ |
| InChIKey | KXRHDDBCMNAAIY-ACCUITESSA-N |
| XLogP | 2.03 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|