C15H12N2 — CID 101239106
5,7-dihydro-4H-pyrrolo[3,2-i]phenanthridine (PubChem CID 101239106) has the molecular formula C15H12N2 and a molecular weight of 220.28 g/mol. Its IUPAC name is 5,7-dihydro-4H-pyrrolo[3,2-i]phenanthridine.
| Compound Name | 5,7-dihydro-4H-pyrrolo[3,2-i]phenanthridine |
|---|---|
| PubChem CID | 101239106 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5,7-dihydro-4H-pyrrolo[3,2-i]phenanthridine |
| SMILES | C1=CC2=c3ccc4c(c3CNC2=CC1)C=CN=4 |
| InChI | InChI=1S/C15H12N2/c1-2-4-14-11(3-1)10-5-6-15-12(7-8-16-15)13(10)9-17-14/h1,3-8,17H,2,9H2 |
| InChIKey | PKPKZQXNDQIQSO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |